C35H37BrO6 — CID 143780104
(2R,3E)-4-bromo-2-(3,5-dimethoxyphenyl)-3-[(2E,3Z)-2-ethylidene-5-methoxyhexa-3,5-dienylidene]-5,7-dimethoxy-1-(4-methoxyphenyl)-1,2-dihydroindene (PubChem CID 143780104) has the molecular formula C35H37BrO6 and a molecular weight of 633.58 g/mol. Its IUPAC name is (2R,3E)-4-bromo-2-(3,5-dimethoxyphenyl)-3-[(2E,3Z)-2-ethylidene-5-methoxyhexa-3,5-dienylidene]-5,7-dimethoxy-1-(4-methoxyphenyl)-1,2-dihydroindene.
| Compound Name | (2R,3E)-4-bromo-2-(3,5-dimethoxyphenyl)-3-[(2E,3Z)-2-ethylidene-5-methoxyhexa-3,5-dienylidene]-5,7-dimethoxy-1-(4-methoxyphenyl)-1,2-dihydroindene |
|---|---|
| PubChem CID | 143780104 |
| Molecular Formula | C35H37BrO6 |
| Molecular Weight | 633.58 g/mol |
| Exact Mass | 632.18 |
| IUPAC Name | (2R,3E)-4-bromo-2-(3,5-dimethoxyphenyl)-3-[(2E,3Z)-2-ethylidene-5-methoxyhexa-3,5-dienylidene]-5,7-dimethoxy-1-(4-methoxyphenyl)-1,2-dihydroindene |
| SMILES | C=C(/C=C\C(=C/C)\C=C1\c2c(Br)c(OC)cc(OC)c2C(c2ccc(OC)cc2)[C@@H]1c1cc(OC)cc(OC)c1)OC |
| InChI | InChI=1S/C35H37BrO6/c1-9-22(11-10-21(2)37-3)16-28-31(24-17-26(39-5)19-27(18-24)40-6)32(23-12-14-25(38-4)15-13-23)34-29(41-7)20-30(42-8)35(36)33(28)34/h9-20,31-32H,2H2,1,3-8H3/b11-10-,22-9+,28-16+/t31-,32?/m1/s1 |
| InChIKey | GFSSPLGLPQQWDQ-XILCCISWSA-N |
| XLogP | 8.47 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.58 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|