About 5-chloro-2-imidazo[4,5-b]pyridin-3-yl-N-methylpyridin-3-amine
5-chloro-2-imidazo[4,5-b]pyridin-3-yl-N-methylpyridin-3-amine (PubChem CID 143780495) has the molecular formula C12H10ClN5
and a molecular weight of 259.70 g/mol. Its IUPAC name is 5-chloro-2-imidazo[4,5-b]pyridin-3-yl-N-methylpyridin-3-amine.
Molecular Properties
| Compound Name | 5-chloro-2-imidazo[4,5-b]pyridin-3-yl-N-methylpyridin-3-amine |
| PubChem CID | 143780495 |
| Molecular Formula | C12H10ClN5 |
| Molecular Weight | 259.70 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | 5-chloro-2-imidazo[4,5-b]pyridin-3-yl-N-methylpyridin-3-amine |
| SMILES | CNc1cc(Cl)cnc1-n1cnc2cccnc21 |
| InChI | InChI=1S/C12H10ClN5/c1-14-10-5-8(13)6-16-12(10)18-7-17-9-3-2-4-15-11(9)18/h2-7,14H,1H3 |
| InChIKey | LPTWJFHAVRWHED-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.70 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-chloro-2-imidazo[4,5-b]pyridin-3-yl-N-methylpyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2-imidazo[4,5-b]pyridin-3-yl-N-methylpyridin-3-amine?
The IUPAC name of 5-chloro-2-imidazo[4,5-b]pyridin-3-yl-N-methylpyridin-3-amine (CID 143780495) is 5-chloro-2-imidazo[4,5-b]pyridin-3-yl-N-methylpyridin-3-amine.
What is the SMILES notation for 5-chloro-2-imidazo[4,5-b]pyridin-3-yl-N-methylpyridin-3-amine?
The canonical SMILES for 5-chloro-2-imidazo[4,5-b]pyridin-3-yl-N-methylpyridin-3-amine is CNc1cc(Cl)cnc1-n1cnc2cccnc21.
What is the InChIKey of 5-chloro-2-imidazo[4,5-b]pyridin-3-yl-N-methylpyridin-3-amine?
The InChIKey is LPTWJFHAVRWHED-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10ClN5/c1-14-10-5-8(13)6-16-12(10)18-7-17-9-3-2-4-15-11(9)18/h2-7,14H,1H3.
What are the key properties of 5-chloro-2-imidazo[4,5-b]pyridin-3-yl-N-methylpyridin-3-amine?
5-chloro-2-imidazo[4,5-b]pyridin-3-yl-N-methylpyridin-3-amine has a molecular weight of 259.70 g/mol, XLogP of 2.51, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2-imidazo[4,5-b]pyridin-3-yl-N-methylpyridin-3-amine is sourced from PubChem (CID 143780495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).