About (1-methylcyclopropyl) 4-[(5-methylpyrazin-2-yl)oxymethyl]piperidine-1-carboxylate
(1-methylcyclopropyl) 4-[(5-methylpyrazin-2-yl)oxymethyl]piperidine-1-carboxylate (PubChem CID 143780657) has the molecular formula C16H23N3O3
and a molecular weight of 305.38 g/mol. Its IUPAC name is (1-methylcyclopropyl) 4-[(5-methylpyrazin-2-yl)oxymethyl]piperidine-1-carboxylate.
Molecular Properties
| Compound Name | (1-methylcyclopropyl) 4-[(5-methylpyrazin-2-yl)oxymethyl]piperidine-1-carboxylate |
| PubChem CID | 143780657 |
| Molecular Formula | C16H23N3O3 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | (1-methylcyclopropyl) 4-[(5-methylpyrazin-2-yl)oxymethyl]piperidine-1-carboxylate |
| SMILES | Cc1cnc(OCC2CCN(C(=O)OC3(C)CC3)CC2)cn1 |
| InChI | InChI=1S/C16H23N3O3/c1-12-9-18-14(10-17-12)21-11-13-3-7-19(8-4-13)15(20)22-16(2)5-6-16/h9-10,13H,3-8,11H2,1-2H3 |
| InChIKey | OHPSXHSPDLPSNR-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (1-methylcyclopropyl) 4-[(5-methylpyrazin-2-yl)oxymethyl]piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methylcyclopropyl) 4-[(5-methylpyrazin-2-yl)oxymethyl]piperidine-1-carboxylate?
The IUPAC name of (1-methylcyclopropyl) 4-[(5-methylpyrazin-2-yl)oxymethyl]piperidine-1-carboxylate (CID 143780657) is (1-methylcyclopropyl) 4-[(5-methylpyrazin-2-yl)oxymethyl]piperidine-1-carboxylate.
What is the SMILES notation for (1-methylcyclopropyl) 4-[(5-methylpyrazin-2-yl)oxymethyl]piperidine-1-carboxylate?
The canonical SMILES for (1-methylcyclopropyl) 4-[(5-methylpyrazin-2-yl)oxymethyl]piperidine-1-carboxylate is Cc1cnc(OCC2CCN(C(=O)OC3(C)CC3)CC2)cn1.
What is the InChIKey of (1-methylcyclopropyl) 4-[(5-methylpyrazin-2-yl)oxymethyl]piperidine-1-carboxylate?
The InChIKey is OHPSXHSPDLPSNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23N3O3/c1-12-9-18-14(10-17-12)21-11-13-3-7-19(8-4-13)15(20)22-16(2)5-6-16/h9-10,13H,3-8,11H2,1-2H3.
What are the key properties of (1-methylcyclopropyl) 4-[(5-methylpyrazin-2-yl)oxymethyl]piperidine-1-carboxylate?
(1-methylcyclopropyl) 4-[(5-methylpyrazin-2-yl)oxymethyl]piperidine-1-carboxylate has a molecular weight of 305.38 g/mol, XLogP of 2.56, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methylcyclopropyl) 4-[(5-methylpyrazin-2-yl)oxymethyl]piperidine-1-carboxylate is sourced from PubChem (CID 143780657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).