C22H20N4O5S — CID 143780822
N-[5-(2,4-dioxopyrimidin-1-yl)-3-[6-(hydroxyamino)naphthalen-2-yl]-2-methoxyphenyl]methanesulfinamide (PubChem CID 143780822) has the molecular formula C22H20N4O5S and a molecular weight of 452.49 g/mol. Its IUPAC name is N-[5-(2,4-dioxopyrimidin-1-yl)-3-[6-(hydroxyamino)naphthalen-2-yl]-2-methoxyphenyl]methanesulfinamide.
| Compound Name | N-[5-(2,4-dioxopyrimidin-1-yl)-3-[6-(hydroxyamino)naphthalen-2-yl]-2-methoxyphenyl]methanesulfinamide |
|---|---|
| PubChem CID | 143780822 |
| Molecular Formula | C22H20N4O5S |
| Molecular Weight | 452.49 g/mol |
| Exact Mass | 452.12 |
| IUPAC Name | N-[5-(2,4-dioxopyrimidin-1-yl)-3-[6-(hydroxyamino)naphthalen-2-yl]-2-methoxyphenyl]methanesulfinamide |
| SMILES | COc1c(NS(C)=O)cc(-n2ccc(=O)[nH]c2=O)cc1-c1ccc2cc(NO)ccc2c1 |
| InChI | InChI=1S/C22H20N4O5S/c1-31-21-18(15-4-3-14-10-16(24-29)6-5-13(14)9-15)11-17(12-19(21)25-32(2)30)26-8-7-20(27)23-22(26)28/h3-12,24-25,29H,1-2H3,(H,23,27,28) |
| InChIKey | QORAGTIQJSWSAO-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 125.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.49 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|