C31H30N2O — CID 143781851
(1E,3E)-1,3-bis(1,3,3-trimethylindol-2-ylidene)inden-2-one (PubChem CID 143781851) has the molecular formula C31H30N2O and a molecular weight of 446.59 g/mol. Its IUPAC name is (1E,3E)-1,3-bis(1,3,3-trimethylindol-2-ylidene)inden-2-one.
| Compound Name | (1E,3E)-1,3-bis(1,3,3-trimethylindol-2-ylidene)inden-2-one |
|---|---|
| PubChem CID | 143781851 |
| Molecular Formula | C31H30N2O |
| Molecular Weight | 446.59 g/mol |
| Exact Mass | 446.24 |
| IUPAC Name | (1E,3E)-1,3-bis(1,3,3-trimethylindol-2-ylidene)inden-2-one |
| SMILES | CN1/C(=C2/C(=O)/C(=C3/N(C)c4ccccc4C3(C)C)c3ccccc32)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C31H30N2O/c1-30(2)21-15-9-11-17-23(21)32(5)28(30)25-19-13-7-8-14-20(19)26(27(25)34)29-31(3,4)22-16-10-12-18-24(22)33(29)6/h7-18H,1-6H3/b28-25+,29-26+ |
| InChIKey | GZMIUZCMTFRFIJ-XQHINZDJSA-N |
| XLogP | 6.55 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.59 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|