About 2-[2-[4-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]butoxy]ethyl]-3-methyl-1H-quinolin-4-one
2-[2-[4-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]butoxy]ethyl]-3-methyl-1H-quinolin-4-one (PubChem CID 143781963) has the molecular formula C26H31NO4
and a molecular weight of 421.54 g/mol. Its IUPAC name is 2-[2-[4-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]butoxy]ethyl]-3-methyl-1H-quinolin-4-one.
Molecular Properties
| Compound Name | 2-[2-[4-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]butoxy]ethyl]-3-methyl-1H-quinolin-4-one |
| PubChem CID | 143781963 |
| Molecular Formula | C26H31NO4 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.23 |
| IUPAC Name | 2-[2-[4-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]butoxy]ethyl]-3-methyl-1H-quinolin-4-one |
| SMILES | Cc1c(CCOCCCCOc2cccc3c2OC(C)(C)C3)[nH]c2ccccc2c1=O |
| InChI | InChI=1S/C26H31NO4/c1-18-21(27-22-11-5-4-10-20(22)24(18)28)13-16-29-14-6-7-15-30-23-12-8-9-19-17-26(2,3)31-25(19)23/h4-5,8-12H,6-7,13-17H2,1-3H3,(H,27,28) |
| InChIKey | XEEIZAPINSOWGV-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 60.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-[4-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]butoxy]ethyl]-3-methyl-1H-quinolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[4-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]butoxy]ethyl]-3-methyl-1H-quinolin-4-one?
The IUPAC name of 2-[2-[4-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]butoxy]ethyl]-3-methyl-1H-quinolin-4-one (CID 143781963) is 2-[2-[4-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]butoxy]ethyl]-3-methyl-1H-quinolin-4-one.
What is the SMILES notation for 2-[2-[4-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]butoxy]ethyl]-3-methyl-1H-quinolin-4-one?
The canonical SMILES for 2-[2-[4-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]butoxy]ethyl]-3-methyl-1H-quinolin-4-one is Cc1c(CCOCCCCOc2cccc3c2OC(C)(C)C3)[nH]c2ccccc2c1=O.
What is the InChIKey of 2-[2-[4-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]butoxy]ethyl]-3-methyl-1H-quinolin-4-one?
The InChIKey is XEEIZAPINSOWGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H31NO4/c1-18-21(27-22-11-5-4-10-20(22)24(18)28)13-16-29-14-6-7-15-30-23-12-8-9-19-17-26(2,3)31-25(19)23/h4-5,8-12H,6-7,13-17H2,1-3H3,(H,27,28).
What are the key properties of 2-[2-[4-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]butoxy]ethyl]-3-methyl-1H-quinolin-4-one?
2-[2-[4-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]butoxy]ethyl]-3-methyl-1H-quinolin-4-one has a molecular weight of 421.54 g/mol, XLogP of 4.97, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[4-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]butoxy]ethyl]-3-methyl-1H-quinolin-4-one is sourced from PubChem (CID 143781963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).