C13H26N2 — CID 143782119
ethene;(Z)-1-N,1-N,3-trimethyl-4-methylidenehept-5-ene-1,3-diamine (PubChem CID 143782119) has the molecular formula C13H26N2 and a molecular weight of 210.36 g/mol. Its IUPAC name is ethene;(Z)-1-N,1-N,3-trimethyl-4-methylidenehept-5-ene-1,3-diamine.
| Compound Name | ethene;(Z)-1-N,1-N,3-trimethyl-4-methylidenehept-5-ene-1,3-diamine |
|---|---|
| PubChem CID | 143782119 |
| Molecular Formula | C13H26N2 |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.21 |
| IUPAC Name | ethene;(Z)-1-N,1-N,3-trimethyl-4-methylidenehept-5-ene-1,3-diamine |
| SMILES | C=C.C=C(/C=C\C)C(C)(N)CCN(C)C |
| InChI | InChI=1S/C11H22N2.C2H4/c1-6-7-10(2)11(3,12)8-9-13(4)5;1-2/h6-7H,2,8-9,12H2,1,3-5H3;1-2H2/b7-6-; |
| InChIKey | SACWJIQDXISLAA-NAFXZHHSSA-N |
| XLogP | 2.59 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|