About 4-ethenyl-3,8-dimethyl-2-oxa-8-azaspiro[4.5]dec-3-ene;prop-1-ene
4-ethenyl-3,8-dimethyl-2-oxa-8-azaspiro[4.5]dec-3-ene;prop-1-ene (PubChem CID 143782132) has the molecular formula C15H25NO
and a molecular weight of 235.37 g/mol. Its IUPAC name is 4-ethenyl-3,8-dimethyl-2-oxa-8-azaspiro[4.5]dec-3-ene;prop-1-ene.
Molecular Properties
| Compound Name | 4-ethenyl-3,8-dimethyl-2-oxa-8-azaspiro[4.5]dec-3-ene;prop-1-ene |
| PubChem CID | 143782132 |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | 4-ethenyl-3,8-dimethyl-2-oxa-8-azaspiro[4.5]dec-3-ene;prop-1-ene |
| SMILES | C=CC.C=CC1=C(C)OCC12CCN(C)CC2 |
| InChI | InChI=1S/C12H19NO.C3H6/c1-4-11-10(2)14-9-12(11)5-7-13(3)8-6-12;1-3-2/h4H,1,5-9H2,2-3H3;3H,1H2,2H3 |
| InChIKey | CKZFGYWLOHAGIT-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-ethenyl-3,8-dimethyl-2-oxa-8-azaspiro[4.5]dec-3-ene;prop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethenyl-3,8-dimethyl-2-oxa-8-azaspiro[4.5]dec-3-ene;prop-1-ene?
The IUPAC name of 4-ethenyl-3,8-dimethyl-2-oxa-8-azaspiro[4.5]dec-3-ene;prop-1-ene (CID 143782132) is 4-ethenyl-3,8-dimethyl-2-oxa-8-azaspiro[4.5]dec-3-ene;prop-1-ene.
What is the SMILES notation for 4-ethenyl-3,8-dimethyl-2-oxa-8-azaspiro[4.5]dec-3-ene;prop-1-ene?
The canonical SMILES for 4-ethenyl-3,8-dimethyl-2-oxa-8-azaspiro[4.5]dec-3-ene;prop-1-ene is C=CC.C=CC1=C(C)OCC12CCN(C)CC2.
What is the InChIKey of 4-ethenyl-3,8-dimethyl-2-oxa-8-azaspiro[4.5]dec-3-ene;prop-1-ene?
The InChIKey is CKZFGYWLOHAGIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NO.C3H6/c1-4-11-10(2)14-9-12(11)5-7-13(3)8-6-12;1-3-2/h4H,1,5-9H2,2-3H3;3H,1H2,2H3.
What are the key properties of 4-ethenyl-3,8-dimethyl-2-oxa-8-azaspiro[4.5]dec-3-ene;prop-1-ene?
4-ethenyl-3,8-dimethyl-2-oxa-8-azaspiro[4.5]dec-3-ene;prop-1-ene has a molecular weight of 235.37 g/mol, XLogP of 3.38, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethenyl-3,8-dimethyl-2-oxa-8-azaspiro[4.5]dec-3-ene;prop-1-ene is sourced from PubChem (CID 143782132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).