C20H30N4O3S — CID 143782268
2-(2-ethoxy-5-methoxysulfanylphenyl)-5-methyl-7-propyl-3H-imidazo[5,1-f][1,2,4]triazin-4-one;methane (PubChem CID 143782268) has the molecular formula C20H30N4O3S and a molecular weight of 406.55 g/mol. Its IUPAC name is 2-(2-ethoxy-5-methoxysulfanylphenyl)-5-methyl-7-propyl-3H-imidazo[5,1-f][1,2,4]triazin-4-one;methane.
| Compound Name | 2-(2-ethoxy-5-methoxysulfanylphenyl)-5-methyl-7-propyl-3H-imidazo[5,1-f][1,2,4]triazin-4-one;methane |
|---|---|
| PubChem CID | 143782268 |
| Molecular Formula | C20H30N4O3S |
| Molecular Weight | 406.55 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | 2-(2-ethoxy-5-methoxysulfanylphenyl)-5-methyl-7-propyl-3H-imidazo[5,1-f][1,2,4]triazin-4-one;methane |
| SMILES | C.C.CCCc1nc(C)c2c(=O)[nH]c(-c3cc(SOC)ccc3OCC)nn12 |
| InChI | InChI=1S/C18H22N4O3S.2CH4/c1-5-7-15-19-11(3)16-18(23)20-17(21-22(15)16)13-10-12(26-24-4)8-9-14(13)25-6-2;;/h8-10H,5-7H2,1-4H3,(H,20,21,23);2*1H4 |
| InChIKey | SGDPVYGCDZVGMX-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.55 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|