C7H13ClO2 — CID 143782457
hept-4-enoic acid;hydrochloride (PubChem CID 143782457) has the molecular formula C7H13ClO2 and a molecular weight of 164.63 g/mol. Its IUPAC name is hept-4-enoic acid;hydrochloride.
| Compound Name | hept-4-enoic acid;hydrochloride |
|---|---|
| PubChem CID | 143782457 |
| Molecular Formula | C7H13ClO2 |
| Molecular Weight | 164.63 g/mol |
| Exact Mass | 164.06 |
| IUPAC Name | hept-4-enoic acid;hydrochloride |
| SMILES | CCC=CCCC(=O)O.Cl |
| InChI | InChI=1S/C7H12O2.ClH/c1-2-3-4-5-6-7(8)9;/h3-4H,2,5-6H2,1H3,(H,8,9);1H |
| InChIKey | VLFIFNJUJDSQDP-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.63 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|