C23H21F3N4O5 — CID 143782573
N-[[3-(2,6-dioxopiperidin-3-yl)-4-hydroxy-2-methyl-4H-quinazolin-6-yl]methyl]-4-(trifluoromethoxy)benzamide (PubChem CID 143782573) has the molecular formula C23H21F3N4O5 and a molecular weight of 490.44 g/mol. Its IUPAC name is N-[[3-(2,6-dioxopiperidin-3-yl)-4-hydroxy-2-methyl-4H-quinazolin-6-yl]methyl]-4-(trifluoromethoxy)benzamide.
| Compound Name | N-[[3-(2,6-dioxopiperidin-3-yl)-4-hydroxy-2-methyl-4H-quinazolin-6-yl]methyl]-4-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 143782573 |
| Molecular Formula | C23H21F3N4O5 |
| Molecular Weight | 490.44 g/mol |
| Exact Mass | 490.15 |
| IUPAC Name | N-[[3-(2,6-dioxopiperidin-3-yl)-4-hydroxy-2-methyl-4H-quinazolin-6-yl]methyl]-4-(trifluoromethoxy)benzamide |
| SMILES | CC1=Nc2ccc(CNC(=O)c3ccc(OC(F)(F)F)cc3)cc2C(O)N1C1CCC(=O)NC1=O |
| InChI | InChI=1S/C23H21F3N4O5/c1-12-28-17-7-2-13(10-16(17)22(34)30(12)18-8-9-19(31)29-21(18)33)11-27-20(32)14-3-5-15(6-4-14)35-23(24,25)26/h2-7,10,18,22,34H,8-9,11H2,1H3,(H,27,32)(H,29,31,33) |
| InChIKey | CMPZIIILPGEPPI-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 120.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.44 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|