About ethane;4-methyl-1H-pyrazolo[3,4-d]pyrimidine
ethane;4-methyl-1H-pyrazolo[3,4-d]pyrimidine (PubChem CID 143782754) has the molecular formula C8H12N4
and a molecular weight of 164.21 g/mol. Its IUPAC name is ethane;4-methyl-1H-pyrazolo[3,4-d]pyrimidine.
Molecular Properties
| Compound Name | ethane;4-methyl-1H-pyrazolo[3,4-d]pyrimidine |
| PubChem CID | 143782754 |
| Molecular Formula | C8H12N4 |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.11 |
| IUPAC Name | ethane;4-methyl-1H-pyrazolo[3,4-d]pyrimidine |
| SMILES | CC.Cc1ncnc2[nH]ncc12 |
| InChI | InChI=1S/C6H6N4.C2H6/c1-4-5-2-9-10-6(5)8-3-7-4;1-2/h2-3H,1H3,(H,7,8,9,10);1-2H3 |
| InChIKey | PKZKICPORUEUFT-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;4-methyl-1H-pyrazolo[3,4-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-methyl-1H-pyrazolo[3,4-d]pyrimidine?
The IUPAC name of ethane;4-methyl-1H-pyrazolo[3,4-d]pyrimidine (CID 143782754) is ethane;4-methyl-1H-pyrazolo[3,4-d]pyrimidine.
What is the SMILES notation for ethane;4-methyl-1H-pyrazolo[3,4-d]pyrimidine?
The canonical SMILES for ethane;4-methyl-1H-pyrazolo[3,4-d]pyrimidine is CC.Cc1ncnc2[nH]ncc12.
What is the InChIKey of ethane;4-methyl-1H-pyrazolo[3,4-d]pyrimidine?
The InChIKey is PKZKICPORUEUFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N4.C2H6/c1-4-5-2-9-10-6(5)8-3-7-4;1-2/h2-3H,1H3,(H,7,8,9,10);1-2H3.
What are the key properties of ethane;4-methyl-1H-pyrazolo[3,4-d]pyrimidine?
ethane;4-methyl-1H-pyrazolo[3,4-d]pyrimidine has a molecular weight of 164.21 g/mol, XLogP of 1.69, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-methyl-1H-pyrazolo[3,4-d]pyrimidine is sourced from PubChem (CID 143782754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).