About N-(1-methylindol-5-yl)-7-azabicyclo[4.2.0]octa-1(6),2-diene-2-carboxamide
N-(1-methylindol-5-yl)-7-azabicyclo[4.2.0]octa-1(6),2-diene-2-carboxamide (PubChem CID 143783441) has the molecular formula C17H17N3O
and a molecular weight of 279.34 g/mol. Its IUPAC name is N-(1-methylindol-5-yl)-7-azabicyclo[4.2.0]octa-1(6),2-diene-2-carboxamide.
Molecular Properties
| Compound Name | N-(1-methylindol-5-yl)-7-azabicyclo[4.2.0]octa-1(6),2-diene-2-carboxamide |
| PubChem CID | 143783441 |
| Molecular Formula | C17H17N3O |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | N-(1-methylindol-5-yl)-7-azabicyclo[4.2.0]octa-1(6),2-diene-2-carboxamide |
| SMILES | Cn1ccc2cc(NC(=O)C3=CCCC4=C3CN4)ccc21 |
| InChI | InChI=1S/C17H17N3O/c1-20-8-7-11-9-12(5-6-16(11)20)19-17(21)13-3-2-4-15-14(13)10-18-15/h3,5-9,18H,2,4,10H2,1H3,(H,19,21) |
| InChIKey | UETFQJSIGBNSGI-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 46.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(1-methylindol-5-yl)-7-azabicyclo[4.2.0]octa-1(6),2-diene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-methylindol-5-yl)-7-azabicyclo[4.2.0]octa-1(6),2-diene-2-carboxamide?
The IUPAC name of N-(1-methylindol-5-yl)-7-azabicyclo[4.2.0]octa-1(6),2-diene-2-carboxamide (CID 143783441) is N-(1-methylindol-5-yl)-7-azabicyclo[4.2.0]octa-1(6),2-diene-2-carboxamide.
What is the SMILES notation for N-(1-methylindol-5-yl)-7-azabicyclo[4.2.0]octa-1(6),2-diene-2-carboxamide?
The canonical SMILES for N-(1-methylindol-5-yl)-7-azabicyclo[4.2.0]octa-1(6),2-diene-2-carboxamide is Cn1ccc2cc(NC(=O)C3=CCCC4=C3CN4)ccc21.
What is the InChIKey of N-(1-methylindol-5-yl)-7-azabicyclo[4.2.0]octa-1(6),2-diene-2-carboxamide?
The InChIKey is UETFQJSIGBNSGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17N3O/c1-20-8-7-11-9-12(5-6-16(11)20)19-17(21)13-3-2-4-15-14(13)10-18-15/h3,5-9,18H,2,4,10H2,1H3,(H,19,21).
What are the key properties of N-(1-methylindol-5-yl)-7-azabicyclo[4.2.0]octa-1(6),2-diene-2-carboxamide?
N-(1-methylindol-5-yl)-7-azabicyclo[4.2.0]octa-1(6),2-diene-2-carboxamide has a molecular weight of 279.34 g/mol, XLogP of 2.69, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-methylindol-5-yl)-7-azabicyclo[4.2.0]octa-1(6),2-diene-2-carboxamide is sourced from PubChem (CID 143783441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).