About 4-(2,5-dioxopyrrol-1-yl)butanamide;molecular hydrogen
4-(2,5-dioxopyrrol-1-yl)butanamide;molecular hydrogen (PubChem CID 143783592) has the molecular formula C8H12N2O3
and a molecular weight of 184.20 g/mol. Its IUPAC name is 4-(2,5-dioxopyrrol-1-yl)butanamide;molecular hydrogen.
Molecular Properties
| Compound Name | 4-(2,5-dioxopyrrol-1-yl)butanamide;molecular hydrogen |
| PubChem CID | 143783592 |
| Molecular Formula | C8H12N2O3 |
| Molecular Weight | 184.20 g/mol |
| Exact Mass | 184.08 |
| IUPAC Name | 4-(2,5-dioxopyrrol-1-yl)butanamide;molecular hydrogen |
| SMILES | NC(=O)CCCN1C(=O)C=CC1=O.[H][H] |
| InChI | InChI=1S/C8H10N2O3.H2/c9-6(11)2-1-5-10-7(12)3-4-8(10)13;/h3-4H,1-2,5H2,(H2,9,11);1H |
| InChIKey | YLAIPFIBKDWWNQ-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.20 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 4-(2,5-dioxopyrrol-1-yl)butanamide;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,5-dioxopyrrol-1-yl)butanamide;molecular hydrogen?
The IUPAC name of 4-(2,5-dioxopyrrol-1-yl)butanamide;molecular hydrogen (CID 143783592) is 4-(2,5-dioxopyrrol-1-yl)butanamide;molecular hydrogen.
What is the SMILES notation for 4-(2,5-dioxopyrrol-1-yl)butanamide;molecular hydrogen?
The canonical SMILES for 4-(2,5-dioxopyrrol-1-yl)butanamide;molecular hydrogen is NC(=O)CCCN1C(=O)C=CC1=O.[H][H].
What is the InChIKey of 4-(2,5-dioxopyrrol-1-yl)butanamide;molecular hydrogen?
The InChIKey is YLAIPFIBKDWWNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O3.H2/c9-6(11)2-1-5-10-7(12)3-4-8(10)13;/h3-4H,1-2,5H2,(H2,9,11);1H.
What are the key properties of 4-(2,5-dioxopyrrol-1-yl)butanamide;molecular hydrogen?
4-(2,5-dioxopyrrol-1-yl)butanamide;molecular hydrogen has a molecular weight of 184.20 g/mol, XLogP of -0.58, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,5-dioxopyrrol-1-yl)butanamide;molecular hydrogen is sourced from PubChem (CID 143783592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).