C18H26O6 — CID 14378366
[(1'S,2'R,3'S,6'S,7'R)-2'-methyl-5'-oxospiro[1,3-dioxolane-2,8'-4-oxatricyclo[5.3.0.02,6]decane]-3'-yl]methyl 2,2-dimethylpropanoate (PubChem CID 14378366) has the molecular formula C18H26O6 and a molecular weight of 338.40 g/mol. Its IUPAC name is [(1'S,2'R,3'S,6'S,7'R)-2'-methyl-5'-oxospiro[1,3-dioxolane-2,8'-4-oxatricyclo[5.3.0.02,6]decane]-3'-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(1'S,2'R,3'S,6'S,7'R)-2'-methyl-5'-oxospiro[1,3-dioxolane-2,8'-4-oxatricyclo[5.3.0.02,6]decane]-3'-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 14378366 |
| Molecular Formula | C18H26O6 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | [(1'S,2'R,3'S,6'S,7'R)-2'-methyl-5'-oxospiro[1,3-dioxolane-2,8'-4-oxatricyclo[5.3.0.02,6]decane]-3'-yl]methyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OC[C@H]1OC(=O)[C@H]2[C@H]3[C@H](CCC34OCCO4)[C@@]12C |
| InChI | InChI=1S/C18H26O6/c1-16(2,3)15(20)21-9-11-17(4)10-5-6-18(22-7-8-23-18)12(10)13(17)14(19)24-11/h10-13H,5-9H2,1-4H3/t10-,11+,12+,13+,17-/m0/s1 |
| InChIKey | RJZVAFMWWHXNJR-NWBJOUOXSA-N |
| XLogP | 1.91 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |