C21H21F3N2O5 — CID 143783706
methyl (Z)-2-[2-[[2-but-3-en-2-yloxy-6-(trifluoromethyl)pyrimidin-4-yl]oxymethyl]phenyl]-3-methoxyprop-2-enoate (PubChem CID 143783706) has the molecular formula C21H21F3N2O5 and a molecular weight of 438.40 g/mol. Its IUPAC name is methyl (Z)-2-[2-[[2-but-3-en-2-yloxy-6-(trifluoromethyl)pyrimidin-4-yl]oxymethyl]phenyl]-3-methoxyprop-2-enoate.
| Compound Name | methyl (Z)-2-[2-[[2-but-3-en-2-yloxy-6-(trifluoromethyl)pyrimidin-4-yl]oxymethyl]phenyl]-3-methoxyprop-2-enoate |
|---|---|
| PubChem CID | 143783706 |
| Molecular Formula | C21H21F3N2O5 |
| Molecular Weight | 438.40 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | methyl (Z)-2-[2-[[2-but-3-en-2-yloxy-6-(trifluoromethyl)pyrimidin-4-yl]oxymethyl]phenyl]-3-methoxyprop-2-enoate |
| SMILES | C=CC(C)Oc1nc(OCc2ccccc2/C(=C/OC)C(=O)OC)cc(C(F)(F)F)n1 |
| InChI | InChI=1S/C21H21F3N2O5/c1-5-13(2)31-20-25-17(21(22,23)24)10-18(26-20)30-11-14-8-6-7-9-15(14)16(12-28-3)19(27)29-4/h5-10,12-13H,1,11H2,2-4H3/b16-12- |
| InChIKey | DDOXXMQMWGKFLQ-VBKFSLOCSA-N |
| XLogP | 4.19 |
| TPSA | 79.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.40 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|