C13H14F3N — CID 143783814
(1R)-1-methyl-5-[4-(trifluoromethyl)phenyl]-3-azabicyclo[3.1.0]hexane (PubChem CID 143783814) has the molecular formula C13H14F3N and a molecular weight of 241.26 g/mol. Its IUPAC name is (1R)-1-methyl-5-[4-(trifluoromethyl)phenyl]-3-azabicyclo[3.1.0]hexane.
| Compound Name | (1R)-1-methyl-5-[4-(trifluoromethyl)phenyl]-3-azabicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 143783814 |
| Molecular Formula | C13H14F3N |
| Molecular Weight | 241.26 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | (1R)-1-methyl-5-[4-(trifluoromethyl)phenyl]-3-azabicyclo[3.1.0]hexane |
| SMILES | C[C@]12CNCC1(c1ccc(C(F)(F)F)cc1)C2 |
| InChI | InChI=1S/C13H14F3N/c1-11-6-12(11,8-17-7-11)9-2-4-10(5-3-9)13(14,15)16/h2-5,17H,6-8H2,1H3/t11-,12?/m0/s1 |
| InChIKey | YYMGTHCCSSYQLC-PXYINDEMSA-N |
| XLogP | 2.96 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.26 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |