C13H18O3 — CID 14378385
(1'S,2'R,6'S,7'R)-6'-methylspiro[1,3-dioxolane-2,10'-tricyclo[5.3.0.02,6]decane]-3'-one (PubChem CID 14378385) has the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. Its IUPAC name is (1'S,2'R,6'S,7'R)-6'-methylspiro[1,3-dioxolane-2,10'-tricyclo[5.3.0.02,6]decane]-3'-one.
| Compound Name | (1'S,2'R,6'S,7'R)-6'-methylspiro[1,3-dioxolane-2,10'-tricyclo[5.3.0.02,6]decane]-3'-one |
|---|---|
| PubChem CID | 14378385 |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | (1'S,2'R,6'S,7'R)-6'-methylspiro[1,3-dioxolane-2,10'-tricyclo[5.3.0.02,6]decane]-3'-one |
| SMILES | C[C@@]12CCC(=O)[C@@H]1[C@@H]1[C@H]2CCC12OCCO2 |
| InChI | InChI=1S/C13H18O3/c1-12-4-3-9(14)11(12)10-8(12)2-5-13(10)15-6-7-16-13/h8,10-11H,2-7H2,1H3/t8-,10+,11-,12+/m1/s1 |
| InChIKey | QEIXUAHXCMGGHY-KLHWPWHYSA-N |
| XLogP | 1.75 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |