C22H23F3N2O2 — CID 143784345
methyl 4-piperidin-1-yl-N-[1-[2-(trifluoromethoxy)phenyl]ethenyl]benzenecarboximidate (PubChem CID 143784345) has the molecular formula C22H23F3N2O2 and a molecular weight of 404.43 g/mol. Its IUPAC name is methyl 4-piperidin-1-yl-N-[1-[2-(trifluoromethoxy)phenyl]ethenyl]benzenecarboximidate.
| Compound Name | methyl 4-piperidin-1-yl-N-[1-[2-(trifluoromethoxy)phenyl]ethenyl]benzenecarboximidate |
|---|---|
| PubChem CID | 143784345 |
| Molecular Formula | C22H23F3N2O2 |
| Molecular Weight | 404.43 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | methyl 4-piperidin-1-yl-N-[1-[2-(trifluoromethoxy)phenyl]ethenyl]benzenecarboximidate |
| SMILES | C=C(/N=C(\OC)c1ccc(N2CCCCC2)cc1)c1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C22H23F3N2O2/c1-16(19-8-4-5-9-20(19)29-22(23,24)25)26-21(28-2)17-10-12-18(13-11-17)27-14-6-3-7-15-27/h4-5,8-13H,1,3,6-7,14-15H2,2H3/b26-21- |
| InChIKey | FHVUHXMZTJTXTM-QLYXXIJNSA-N |
| XLogP | 5.64 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.43 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|