C12H18N2O2 — CID 143785043
(4S)-4-[(4-aminophenyl)methyl]-1,3-oxazolidin-2-one;ethane (PubChem CID 143785043) has the molecular formula C12H18N2O2 and a molecular weight of 222.29 g/mol. Its IUPAC name is (4S)-4-[(4-aminophenyl)methyl]-1,3-oxazolidin-2-one;ethane.
| Compound Name | (4S)-4-[(4-aminophenyl)methyl]-1,3-oxazolidin-2-one;ethane |
|---|---|
| PubChem CID | 143785043 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | (4S)-4-[(4-aminophenyl)methyl]-1,3-oxazolidin-2-one;ethane |
| SMILES | CC.Nc1ccc(C[C@H]2COC(=O)N2)cc1 |
| InChI | InChI=1S/C10H12N2O2.C2H6/c11-8-3-1-7(2-4-8)5-9-6-14-10(13)12-9;1-2/h1-4,9H,5-6,11H2,(H,12,13);1-2H3/t9-;/m0./s1 |
| InChIKey | BUJZSBDAELVGHB-FVGYRXGTSA-N |
| XLogP | 1.95 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|