About 5-(3,4-difluorophenyl)-3-[(3,5-difluorophenyl)methyl]-3-methyl-1H-indol-2-one
5-(3,4-difluorophenyl)-3-[(3,5-difluorophenyl)methyl]-3-methyl-1H-indol-2-one (PubChem CID 143785636) has the molecular formula C22H15F4NO
and a molecular weight of 385.36 g/mol. Its IUPAC name is 5-(3,4-difluorophenyl)-3-[(3,5-difluorophenyl)methyl]-3-methyl-1H-indol-2-one.
Molecular Properties
| Compound Name | 5-(3,4-difluorophenyl)-3-[(3,5-difluorophenyl)methyl]-3-methyl-1H-indol-2-one |
| PubChem CID | 143785636 |
| Molecular Formula | C22H15F4NO |
| Molecular Weight | 385.36 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | 5-(3,4-difluorophenyl)-3-[(3,5-difluorophenyl)methyl]-3-methyl-1H-indol-2-one |
| SMILES | CC1(Cc2cc(F)cc(F)c2)C(=O)Nc2ccc(-c3ccc(F)c(F)c3)cc21 |
| InChI | InChI=1S/C22H15F4NO/c1-22(11-12-6-15(23)10-16(24)7-12)17-8-13(3-5-20(17)27-21(22)28)14-2-4-18(25)19(26)9-14/h2-10H,11H2,1H3,(H,27,28) |
| InChIKey | DMDUMTMDXHYYSS-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 385.36 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-(3,4-difluorophenyl)-3-[(3,5-difluorophenyl)methyl]-3-methyl-1H-indol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3,4-difluorophenyl)-3-[(3,5-difluorophenyl)methyl]-3-methyl-1H-indol-2-one?
The IUPAC name of 5-(3,4-difluorophenyl)-3-[(3,5-difluorophenyl)methyl]-3-methyl-1H-indol-2-one (CID 143785636) is 5-(3,4-difluorophenyl)-3-[(3,5-difluorophenyl)methyl]-3-methyl-1H-indol-2-one.
What is the SMILES notation for 5-(3,4-difluorophenyl)-3-[(3,5-difluorophenyl)methyl]-3-methyl-1H-indol-2-one?
The canonical SMILES for 5-(3,4-difluorophenyl)-3-[(3,5-difluorophenyl)methyl]-3-methyl-1H-indol-2-one is CC1(Cc2cc(F)cc(F)c2)C(=O)Nc2ccc(-c3ccc(F)c(F)c3)cc21.
What is the InChIKey of 5-(3,4-difluorophenyl)-3-[(3,5-difluorophenyl)methyl]-3-methyl-1H-indol-2-one?
The InChIKey is DMDUMTMDXHYYSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H15F4NO/c1-22(11-12-6-15(23)10-16(24)7-12)17-8-13(3-5-20(17)27-21(22)28)14-2-4-18(25)19(26)9-14/h2-10H,11H2,1H3,(H,27,28).
What are the key properties of 5-(3,4-difluorophenyl)-3-[(3,5-difluorophenyl)methyl]-3-methyl-1H-indol-2-one?
5-(3,4-difluorophenyl)-3-[(3,5-difluorophenyl)methyl]-3-methyl-1H-indol-2-one has a molecular weight of 385.36 g/mol, XLogP of 5.36, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3,4-difluorophenyl)-3-[(3,5-difluorophenyl)methyl]-3-methyl-1H-indol-2-one is sourced from PubChem (CID 143785636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).