C13H19NO2 — CID 143786670
3-[(1R,3S,8S)-2,7-dioxatricyclo[6.3.1.01,6]dodec-10-en-3-yl]propanenitrile;molecular hydrogen (PubChem CID 143786670) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is 3-[(1R,3S,8S)-2,7-dioxatricyclo[6.3.1.01,6]dodec-10-en-3-yl]propanenitrile;molecular hydrogen.
| Compound Name | 3-[(1R,3S,8S)-2,7-dioxatricyclo[6.3.1.01,6]dodec-10-en-3-yl]propanenitrile;molecular hydrogen |
|---|---|
| PubChem CID | 143786670 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | 3-[(1R,3S,8S)-2,7-dioxatricyclo[6.3.1.01,6]dodec-10-en-3-yl]propanenitrile;molecular hydrogen |
| SMILES | N#CCC[C@H]1CCC2O[C@H]3CC=C[C@@]2(C3)O1.[H][H] |
| InChI | InChI=1S/C13H17NO2.H2/c14-8-2-4-10-5-6-12-13(16-10)7-1-3-11(9-13)15-12;/h1,7,10-12H,2-6,9H2;1H/t10-,11-,12?,13-;/m0./s1 |
| InChIKey | LNAJHSWLTFYEIX-HFERHFCYSA-N |
| XLogP | 2.57 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|