C19H33NO4 — CID 143786682
ethane;methyl 3-[(2S,3aS,5R,7aS)-5-[(2R)-2-cyanopropyl]-3a-ethyl-2,3,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-yl]propanoate (PubChem CID 143786682) has the molecular formula C19H33NO4 and a molecular weight of 339.48 g/mol. Its IUPAC name is ethane;methyl 3-[(2S,3aS,5R,7aS)-5-[(2R)-2-cyanopropyl]-3a-ethyl-2,3,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-yl]propanoate.
| Compound Name | ethane;methyl 3-[(2S,3aS,5R,7aS)-5-[(2R)-2-cyanopropyl]-3a-ethyl-2,3,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-yl]propanoate |
|---|---|
| PubChem CID | 143786682 |
| Molecular Formula | C19H33NO4 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.24 |
| IUPAC Name | ethane;methyl 3-[(2S,3aS,5R,7aS)-5-[(2R)-2-cyanopropyl]-3a-ethyl-2,3,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-yl]propanoate |
| SMILES | CC.CC[C@]12C[C@H](CCC(=O)OC)O[C@H]1CC[C@H](CC(C)C#N)O2 |
| InChI | InChI=1S/C17H27NO4.C2H6/c1-4-17-10-14(6-8-16(19)20-3)21-15(17)7-5-13(22-17)9-12(2)11-18;1-2/h12-15H,4-10H2,1-3H3;1-2H3/t12?,13-,14+,15+,17+;/m1./s1 |
| InChIKey | GSJKVTLDPNYPBC-XTMUUMAOSA-N |
| XLogP | 4.00 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |