C13H18BrNO2 — CID 143786690
3-[(1R,3S,8R,10R)-10-bromo-2,7-dioxatricyclo[6.3.1.01,6]dodecan-3-yl]propanenitrile (PubChem CID 143786690) has the molecular formula C13H18BrNO2 and a molecular weight of 300.20 g/mol. Its IUPAC name is 3-[(1R,3S,8R,10R)-10-bromo-2,7-dioxatricyclo[6.3.1.01,6]dodecan-3-yl]propanenitrile.
| Compound Name | 3-[(1R,3S,8R,10R)-10-bromo-2,7-dioxatricyclo[6.3.1.01,6]dodecan-3-yl]propanenitrile |
|---|---|
| PubChem CID | 143786690 |
| Molecular Formula | C13H18BrNO2 |
| Molecular Weight | 300.20 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | 3-[(1R,3S,8R,10R)-10-bromo-2,7-dioxatricyclo[6.3.1.01,6]dodecan-3-yl]propanenitrile |
| SMILES | N#CCC[C@H]1CCC2O[C@H]3C[C@@H](Br)C[C@@]2(C3)O1 |
| InChI | InChI=1S/C13H18BrNO2/c14-9-6-11-8-13(7-9)12(16-11)4-3-10(17-13)2-1-5-15/h9-12H,1-4,6-8H2/t9-,10+,11+,12?,13+/m1/s1 |
| InChIKey | ZGDYPNHMJCZWFR-GRZVIAIVSA-N |
| XLogP | 2.92 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.20 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|