C11H16O2 — CID 143786712
(1R,3S)-3-methyl-2,7-dioxatricyclo[6.3.1.01,6]dodec-10-ene (PubChem CID 143786712) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is (1R,3S)-3-methyl-2,7-dioxatricyclo[6.3.1.01,6]dodec-10-ene.
| Compound Name | (1R,3S)-3-methyl-2,7-dioxatricyclo[6.3.1.01,6]dodec-10-ene |
|---|---|
| PubChem CID | 143786712 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | (1R,3S)-3-methyl-2,7-dioxatricyclo[6.3.1.01,6]dodec-10-ene |
| SMILES | C[C@H]1CCC2OC3CC=C[C@@]2(C3)O1 |
| InChI | InChI=1S/C11H16O2/c1-8-4-5-10-11(13-8)6-2-3-9(7-11)12-10/h2,6,8-10H,3-5,7H2,1H3/t8-,9?,10?,11-/m0/s1 |
| InChIKey | LZVPQIICPRMBTQ-PMUOWJKOSA-N |
| XLogP | 2.04 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|