About ethane;2-methanimidoyl-4-methylaniline;4-methylpyridine
ethane;2-methanimidoyl-4-methylaniline;4-methylpyridine (PubChem CID 143786948) has the molecular formula C16H23N3
and a molecular weight of 257.38 g/mol. Its IUPAC name is ethane;2-methanimidoyl-4-methylaniline;4-methylpyridine.
Molecular Properties
| Compound Name | ethane;2-methanimidoyl-4-methylaniline;4-methylpyridine |
| PubChem CID | 143786948 |
| Molecular Formula | C16H23N3 |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.19 |
| IUPAC Name | ethane;2-methanimidoyl-4-methylaniline;4-methylpyridine |
| SMILES | CC.Cc1ccncc1.[H]/N=C/c1cc(C)ccc1N |
| InChI | InChI=1S/C8H10N2.C6H7N.C2H6/c1-6-2-3-8(10)7(4-6)5-9;1-6-2-4-7-5-3-6;1-2/h2-5,9H,10H2,1H3;2-5H,1H3;1-2H3/b9-5+;; |
| InChIKey | ZDJAQJQYQPCEAG-KJDUPKRESA-N |
| XLogP | 3.99 |
| TPSA | 62.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-methanimidoyl-4-methylaniline;4-methylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methanimidoyl-4-methylaniline;4-methylpyridine?
The IUPAC name of ethane;2-methanimidoyl-4-methylaniline;4-methylpyridine (CID 143786948) is ethane;2-methanimidoyl-4-methylaniline;4-methylpyridine.
What is the SMILES notation for ethane;2-methanimidoyl-4-methylaniline;4-methylpyridine?
The canonical SMILES for ethane;2-methanimidoyl-4-methylaniline;4-methylpyridine is CC.Cc1ccncc1.[H]/N=C/c1cc(C)ccc1N.
What is the InChIKey of ethane;2-methanimidoyl-4-methylaniline;4-methylpyridine?
The InChIKey is ZDJAQJQYQPCEAG-KJDUPKRESA-N. The full InChI is InChI=1S/C8H10N2.C6H7N.C2H6/c1-6-2-3-8(10)7(4-6)5-9;1-6-2-4-7-5-3-6;1-2/h2-5,9H,10H2,1H3;2-5H,1H3;1-2H3/b9-5+;;.
What are the key properties of ethane;2-methanimidoyl-4-methylaniline;4-methylpyridine?
ethane;2-methanimidoyl-4-methylaniline;4-methylpyridine has a molecular weight of 257.38 g/mol, XLogP of 3.99, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methanimidoyl-4-methylaniline;4-methylpyridine is sourced from PubChem (CID 143786948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).