About 6,6-dimethylazepine-2,3-diol
6,6-dimethylazepine-2,3-diol (PubChem CID 143787306) has the molecular formula C8H11NO2
and a molecular weight of 153.18 g/mol. Its IUPAC name is 6,6-dimethylazepine-2,3-diol.
Molecular Properties
| Compound Name | 6,6-dimethylazepine-2,3-diol |
| PubChem CID | 143787306 |
| Molecular Formula | C8H11NO2 |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.08 |
| IUPAC Name | 6,6-dimethylazepine-2,3-diol |
| SMILES | CC1(C)C=CC(O)=C(O)N=C1 |
| InChI | InChI=1S/C8H11NO2/c1-8(2)4-3-6(10)7(11)9-5-8/h3-5,10-11H,1-2H3 |
| InChIKey | GHAJMJQJBQEVFI-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6,6-dimethylazepine-2,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,6-dimethylazepine-2,3-diol?
The IUPAC name of 6,6-dimethylazepine-2,3-diol (CID 143787306) is 6,6-dimethylazepine-2,3-diol.
What is the SMILES notation for 6,6-dimethylazepine-2,3-diol?
The canonical SMILES for 6,6-dimethylazepine-2,3-diol is CC1(C)C=CC(O)=C(O)N=C1.
What is the InChIKey of 6,6-dimethylazepine-2,3-diol?
The InChIKey is GHAJMJQJBQEVFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO2/c1-8(2)4-3-6(10)7(11)9-5-8/h3-5,10-11H,1-2H3.
What are the key properties of 6,6-dimethylazepine-2,3-diol?
6,6-dimethylazepine-2,3-diol has a molecular weight of 153.18 g/mol, XLogP of 1.94, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6,6-dimethylazepine-2,3-diol is sourced from PubChem (CID 143787306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).