About CID 143787315
CID 143787315 (PubChem CID 143787315) has the molecular formula C32H39Cl2N6O5S+
and a molecular weight of 690.67 g/mol.
Molecular Properties
| Compound Name | CID 143787315 |
| PubChem CID | 143787315 |
| Molecular Formula | C32H39Cl2N6O5S+ |
| Molecular Weight | 690.67 g/mol |
| Exact Mass | 689.21 |
| IUPAC Name | — |
| SMILES | COc1cc(C2=N[C@@](C)(c3ccc(Cl)cc3)[C@@](C)(c3ccc(Cl)cc3)N2C(=O)N2CCN(CCC[S+](C)(=O)O)CC2)c(OC)nn1 |
| InChI | InChI=1S/C32H38Cl2N6O5S/c1-31(22-7-11-24(33)12-8-22)32(2,23-9-13-25(34)14-10-23)40(28(35-31)26-21-27(44-3)36-37-29(26)45-4)30(41)39-18-16-38(17-19-39)15-6-20-46(5,42)43/h7-14,21H,6,15-20H2,1-5H3/p+1/t31-,32+/m0/s1 |
| InChIKey | RFHZUBYNMUNUKL-AJQTZOPKSA-O |
| XLogP | 5.42 |
| TPSA | 120.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 690.67 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze CID 143787315 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 143787315?
The IUPAC name of CID 143787315 (CID 143787315) is not available.
What is the SMILES notation for CID 143787315?
The canonical SMILES for CID 143787315 is COc1cc(C2=N[C@@](C)(c3ccc(Cl)cc3)[C@@](C)(c3ccc(Cl)cc3)N2C(=O)N2CCN(CCC[S+](C)(=O)O)CC2)c(OC)nn1.
What is the InChIKey of CID 143787315?
The InChIKey is RFHZUBYNMUNUKL-AJQTZOPKSA-O. The full InChI is InChI=1S/C32H38Cl2N6O5S/c1-31(22-7-11-24(33)12-8-22)32(2,23-9-13-25(34)14-10-23)40(28(35-31)26-21-27(44-3)36-37-29(26)45-4)30(41)39-18-16-38(17-19-39)15-6-20-46(5,42)43/h7-14,21H,6,15-20H2,1-5H3/p+1/t31-,32+/m0/s1.
What are the key properties of CID 143787315?
CID 143787315 has a molecular weight of 690.67 g/mol, XLogP of 5.42, 9 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for CID 143787315 is sourced from PubChem (CID 143787315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).