C19H21ClN2O2 — CID 143787901
3-(2-chloroethyl)-9-[(2E,4Z)-2-ethenylhexa-2,4-dienoxy]-2-methylpyrido[1,2-a]pyrimidin-4-one (PubChem CID 143787901) has the molecular formula C19H21ClN2O2 and a molecular weight of 344.84 g/mol. Its IUPAC name is 3-(2-chloroethyl)-9-[(2E,4Z)-2-ethenylhexa-2,4-dienoxy]-2-methylpyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 3-(2-chloroethyl)-9-[(2E,4Z)-2-ethenylhexa-2,4-dienoxy]-2-methylpyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 143787901 |
| Molecular Formula | C19H21ClN2O2 |
| Molecular Weight | 344.84 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 3-(2-chloroethyl)-9-[(2E,4Z)-2-ethenylhexa-2,4-dienoxy]-2-methylpyrido[1,2-a]pyrimidin-4-one |
| SMILES | C=C/C(=C\C=C/C)COc1cccn2c(=O)c(CCCl)c(C)nc12 |
| InChI | InChI=1S/C19H21ClN2O2/c1-4-6-8-15(5-2)13-24-17-9-7-12-22-18(17)21-14(3)16(10-11-20)19(22)23/h4-9,12H,2,10-11,13H2,1,3H3/b6-4-,15-8+ |
| InChIKey | KWAJPGZNFRPCOI-KKMCOEOTSA-N |
| XLogP | 3.85 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.84 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|