C25H26F3N5O4S — CID 143787994
[3-[2-[4-(2-pyrrolidin-1-ylethoxy)anilino]-[1,2,4]triazolo[1,5-a]pyridin-5-yl]cyclohexa-2,4-dien-1-yl] trifluoromethanesulfonate (PubChem CID 143787994) has the molecular formula C25H26F3N5O4S and a molecular weight of 549.58 g/mol. Its IUPAC name is [3-[2-[4-(2-pyrrolidin-1-ylethoxy)anilino]-[1,2,4]triazolo[1,5-a]pyridin-5-yl]cyclohexa-2,4-dien-1-yl] trifluoromethanesulfonate.
| Compound Name | [3-[2-[4-(2-pyrrolidin-1-ylethoxy)anilino]-[1,2,4]triazolo[1,5-a]pyridin-5-yl]cyclohexa-2,4-dien-1-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 143787994 |
| Molecular Formula | C25H26F3N5O4S |
| Molecular Weight | 549.58 g/mol |
| Exact Mass | 549.17 |
| IUPAC Name | [3-[2-[4-(2-pyrrolidin-1-ylethoxy)anilino]-[1,2,4]triazolo[1,5-a]pyridin-5-yl]cyclohexa-2,4-dien-1-yl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(OC1C=C(c2cccc3nc(Nc4ccc(OCCN5CCCC5)cc4)nn23)C=CC1)C(F)(F)F |
| InChI | InChI=1S/C25H26F3N5O4S/c26-25(27,28)38(34,35)37-21-6-3-5-18(17-21)22-7-4-8-23-30-24(31-33(22)23)29-19-9-11-20(12-10-19)36-16-15-32-13-1-2-14-32/h3-5,7-12,17,21H,1-2,6,13-16H2,(H,29,31) |
| InChIKey | LORXLRADNGAWNY-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 98.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.58 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|