About [(E)-1-[tert-butyl(dimethyl)silyl]oxy-5-iodo-4-methylpent-4-en-2-yl] 4-bromo-3-oxobutanoate
[(E)-1-[tert-butyl(dimethyl)silyl]oxy-5-iodo-4-methylpent-4-en-2-yl] 4-bromo-3-oxobutanoate (PubChem CID 14378828) has the molecular formula C16H28BrIO4Si
and a molecular weight of 519.29 g/mol. Its IUPAC name is [(E)-1-[tert-butyl(dimethyl)silyl]oxy-5-iodo-4-methylpent-4-en-2-yl] 4-bromo-3-oxobutanoate.
Molecular Properties
| Compound Name | [(E)-1-[tert-butyl(dimethyl)silyl]oxy-5-iodo-4-methylpent-4-en-2-yl] 4-bromo-3-oxobutanoate |
| PubChem CID | 14378828 |
| Molecular Formula | C16H28BrIO4Si |
| Molecular Weight | 519.29 g/mol |
| Exact Mass | 518.00 |
| IUPAC Name | [(E)-1-[tert-butyl(dimethyl)silyl]oxy-5-iodo-4-methylpent-4-en-2-yl] 4-bromo-3-oxobutanoate |
| SMILES | C/C(=C\I)CC(CO[Si](C)(C)C(C)(C)C)OC(=O)CC(=O)CBr |
| InChI | InChI=1S/C16H28BrIO4Si/c1-12(10-18)7-14(22-15(20)8-13(19)9-17)11-21-23(5,6)16(2,3)4/h10,14H,7-9,11H2,1-6H3/b12-10+ |
| InChIKey | WEHWJHGHUNSOQZ-ZRDIBKRKSA-N |
| XLogP | 5.00 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 519.29 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze [(E)-1-[tert-butyl(dimethyl)silyl]oxy-5-iodo-4-methylpent-4-en-2-yl] 4-bromo-3-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-1-[tert-butyl(dimethyl)silyl]oxy-5-iodo-4-methylpent-4-en-2-yl] 4-bromo-3-oxobutanoate?
The IUPAC name of [(E)-1-[tert-butyl(dimethyl)silyl]oxy-5-iodo-4-methylpent-4-en-2-yl] 4-bromo-3-oxobutanoate (CID 14378828) is [(E)-1-[tert-butyl(dimethyl)silyl]oxy-5-iodo-4-methylpent-4-en-2-yl] 4-bromo-3-oxobutanoate.
What is the SMILES notation for [(E)-1-[tert-butyl(dimethyl)silyl]oxy-5-iodo-4-methylpent-4-en-2-yl] 4-bromo-3-oxobutanoate?
The canonical SMILES for [(E)-1-[tert-butyl(dimethyl)silyl]oxy-5-iodo-4-methylpent-4-en-2-yl] 4-bromo-3-oxobutanoate is C/C(=C\I)CC(CO[Si](C)(C)C(C)(C)C)OC(=O)CC(=O)CBr.
What is the InChIKey of [(E)-1-[tert-butyl(dimethyl)silyl]oxy-5-iodo-4-methylpent-4-en-2-yl] 4-bromo-3-oxobutanoate?
The InChIKey is WEHWJHGHUNSOQZ-ZRDIBKRKSA-N. The full InChI is InChI=1S/C16H28BrIO4Si/c1-12(10-18)7-14(22-15(20)8-13(19)9-17)11-21-23(5,6)16(2,3)4/h10,14H,7-9,11H2,1-6H3/b12-10+.
What are the key properties of [(E)-1-[tert-butyl(dimethyl)silyl]oxy-5-iodo-4-methylpent-4-en-2-yl] 4-bromo-3-oxobutanoate?
[(E)-1-[tert-butyl(dimethyl)silyl]oxy-5-iodo-4-methylpent-4-en-2-yl] 4-bromo-3-oxobutanoate has a molecular weight of 519.29 g/mol, XLogP of 5.00, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-1-[tert-butyl(dimethyl)silyl]oxy-5-iodo-4-methylpent-4-en-2-yl] 4-bromo-3-oxobutanoate is sourced from PubChem (CID 14378828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).