C20H26O5 — CID 14378891
3,5,6,10-tetrahydroxy-1,1,4a-trimethyl-7-propan-2-yl-3,4-dihydro-2H-phenanthren-9-one (PubChem CID 14378891) has the molecular formula C20H26O5 and a molecular weight of 346.42 g/mol. Its IUPAC name is 3,5,6,10-tetrahydroxy-1,1,4a-trimethyl-7-propan-2-yl-3,4-dihydro-2H-phenanthren-9-one.
| Compound Name | 3,5,6,10-tetrahydroxy-1,1,4a-trimethyl-7-propan-2-yl-3,4-dihydro-2H-phenanthren-9-one |
|---|---|
| PubChem CID | 14378891 |
| Molecular Formula | C20H26O5 |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | 3,5,6,10-tetrahydroxy-1,1,4a-trimethyl-7-propan-2-yl-3,4-dihydro-2H-phenanthren-9-one |
| SMILES | CC(C)c1cc2c(c(O)c1O)C1(C)CC(O)CC(C)(C)C1=C(O)C2=O |
| InChI | InChI=1S/C20H26O5/c1-9(2)11-6-12-13(16(24)14(11)22)20(5)8-10(21)7-19(3,4)18(20)17(25)15(12)23/h6,9-10,21-22,24-25H,7-8H2,1-5H3 |
| InChIKey | PVXSUCBMIJYLBO-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|