C12H20ClN3O2 — CID 143790142
3-(2-chloroethyl)-2-oxo-4,5,5a,6,7,8,9,9a-octahydro-1H-benzo[d][1,3]diazepine-9-carboxamide (PubChem CID 143790142) has the molecular formula C12H20ClN3O2 and a molecular weight of 273.76 g/mol. Its IUPAC name is 3-(2-chloroethyl)-2-oxo-4,5,5a,6,7,8,9,9a-octahydro-1H-benzo[d][1,3]diazepine-9-carboxamide.
| Compound Name | 3-(2-chloroethyl)-2-oxo-4,5,5a,6,7,8,9,9a-octahydro-1H-benzo[d][1,3]diazepine-9-carboxamide |
|---|---|
| PubChem CID | 143790142 |
| Molecular Formula | C12H20ClN3O2 |
| Molecular Weight | 273.76 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | 3-(2-chloroethyl)-2-oxo-4,5,5a,6,7,8,9,9a-octahydro-1H-benzo[d][1,3]diazepine-9-carboxamide |
| SMILES | NC(=O)C1CCCC2CCN(CCCl)C(=O)NC21 |
| InChI | InChI=1S/C12H20ClN3O2/c13-5-7-16-6-4-8-2-1-3-9(11(14)17)10(8)15-12(16)18/h8-10H,1-7H2,(H2,14,17)(H,15,18) |
| InChIKey | CWVOMSFNLNWMFL-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.76 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|