C10H12F4N2S — CID 143790172
7-ethyl-3-(fluoromethyl)-6-(2,2,2-trifluoroethyl)-1H-1,3-diazepine-2-thione (PubChem CID 143790172) has the molecular formula C10H12F4N2S and a molecular weight of 268.28 g/mol. Its IUPAC name is 7-ethyl-3-(fluoromethyl)-6-(2,2,2-trifluoroethyl)-1H-1,3-diazepine-2-thione.
| Compound Name | 7-ethyl-3-(fluoromethyl)-6-(2,2,2-trifluoroethyl)-1H-1,3-diazepine-2-thione |
|---|---|
| PubChem CID | 143790172 |
| Molecular Formula | C10H12F4N2S |
| Molecular Weight | 268.28 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | 7-ethyl-3-(fluoromethyl)-6-(2,2,2-trifluoroethyl)-1H-1,3-diazepine-2-thione |
| SMILES | CCC1=C(CC(F)(F)F)C=CN(CF)C(=S)N1 |
| InChI | InChI=1S/C10H12F4N2S/c1-2-8-7(5-10(12,13)14)3-4-16(6-11)9(17)15-8/h3-4H,2,5-6H2,1H3,(H,15,17) |
| InChIKey | IHTZHNZYAZZQGT-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.28 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|