About (2-chloro-4-thiophen-2-ylpyrrolo[2,3-d]pyrimidin-7-yl) thiohypoiodite
(2-chloro-4-thiophen-2-ylpyrrolo[2,3-d]pyrimidin-7-yl) thiohypoiodite (PubChem CID 143790368) has the molecular formula C10H5ClIN3S2
and a molecular weight of 393.66 g/mol. Its IUPAC name is (2-chloro-4-thiophen-2-ylpyrrolo[2,3-d]pyrimidin-7-yl) thiohypoiodite.
Molecular Properties
| Compound Name | (2-chloro-4-thiophen-2-ylpyrrolo[2,3-d]pyrimidin-7-yl) thiohypoiodite |
| PubChem CID | 143790368 |
| Molecular Formula | C10H5ClIN3S2 |
| Molecular Weight | 393.66 g/mol |
| Exact Mass | 392.87 |
| IUPAC Name | (2-chloro-4-thiophen-2-ylpyrrolo[2,3-d]pyrimidin-7-yl) thiohypoiodite |
| SMILES | Clc1nc(-c2cccs2)c2ccn(SI)c2n1 |
| InChI | InChI=1S/C10H5ClIN3S2/c11-10-13-8(7-2-1-5-16-7)6-3-4-15(17-12)9(6)14-10/h1-5H |
| InChIKey | GULDHKUHMVJGAX-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.66 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (2-chloro-4-thiophen-2-ylpyrrolo[2,3-d]pyrimidin-7-yl) thiohypoiodite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-chloro-4-thiophen-2-ylpyrrolo[2,3-d]pyrimidin-7-yl) thiohypoiodite?
The IUPAC name of (2-chloro-4-thiophen-2-ylpyrrolo[2,3-d]pyrimidin-7-yl) thiohypoiodite (CID 143790368) is (2-chloro-4-thiophen-2-ylpyrrolo[2,3-d]pyrimidin-7-yl) thiohypoiodite.
What is the SMILES notation for (2-chloro-4-thiophen-2-ylpyrrolo[2,3-d]pyrimidin-7-yl) thiohypoiodite?
The canonical SMILES for (2-chloro-4-thiophen-2-ylpyrrolo[2,3-d]pyrimidin-7-yl) thiohypoiodite is Clc1nc(-c2cccs2)c2ccn(SI)c2n1.
What is the InChIKey of (2-chloro-4-thiophen-2-ylpyrrolo[2,3-d]pyrimidin-7-yl) thiohypoiodite?
The InChIKey is GULDHKUHMVJGAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H5ClIN3S2/c11-10-13-8(7-2-1-5-16-7)6-3-4-15(17-12)9(6)14-10/h1-5H.
What are the key properties of (2-chloro-4-thiophen-2-ylpyrrolo[2,3-d]pyrimidin-7-yl) thiohypoiodite?
(2-chloro-4-thiophen-2-ylpyrrolo[2,3-d]pyrimidin-7-yl) thiohypoiodite has a molecular weight of 393.66 g/mol, XLogP of 4.66, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-chloro-4-thiophen-2-ylpyrrolo[2,3-d]pyrimidin-7-yl) thiohypoiodite is sourced from PubChem (CID 143790368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).