C12H13NS — CID 143790413
2,3-bis(ethenyl)-3,4-dihydro-2H-1,4-benzothiazine (PubChem CID 143790413) has the molecular formula C12H13NS and a molecular weight of 203.31 g/mol. Its IUPAC name is 2,3-bis(ethenyl)-3,4-dihydro-2H-1,4-benzothiazine.
| Compound Name | 2,3-bis(ethenyl)-3,4-dihydro-2H-1,4-benzothiazine |
|---|---|
| PubChem CID | 143790413 |
| Molecular Formula | C12H13NS |
| Molecular Weight | 203.31 g/mol |
| Exact Mass | 203.08 |
| IUPAC Name | 2,3-bis(ethenyl)-3,4-dihydro-2H-1,4-benzothiazine |
| SMILES | C=CC1Nc2ccccc2SC1C=C |
| InChI | InChI=1S/C12H13NS/c1-3-9-11(4-2)14-12-8-6-5-7-10(12)13-9/h3-9,11,13H,1-2H2 |
| InChIKey | BVJXGBGUZRUGPS-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.31 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|