About 2-benzyl-5-tert-butyl-N-(3-sulfinamoylphenyl)-1,2,4-triazole-3-carboxamide
2-benzyl-5-tert-butyl-N-(3-sulfinamoylphenyl)-1,2,4-triazole-3-carboxamide (PubChem CID 143790585) has the molecular formula C20H23N5O2S
and a molecular weight of 397.50 g/mol. Its IUPAC name is 2-benzyl-5-tert-butyl-N-(3-sulfinamoylphenyl)-1,2,4-triazole-3-carboxamide.
Molecular Properties
| Compound Name | 2-benzyl-5-tert-butyl-N-(3-sulfinamoylphenyl)-1,2,4-triazole-3-carboxamide |
| PubChem CID | 143790585 |
| Molecular Formula | C20H23N5O2S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | 2-benzyl-5-tert-butyl-N-(3-sulfinamoylphenyl)-1,2,4-triazole-3-carboxamide |
| SMILES | CC(C)(C)c1nc(C(=O)Nc2cccc(S(N)=O)c2)n(Cc2ccccc2)n1 |
| InChI | InChI=1S/C20H23N5O2S/c1-20(2,3)19-23-17(25(24-19)13-14-8-5-4-6-9-14)18(26)22-15-10-7-11-16(12-15)28(21)27/h4-12H,13,21H2,1-3H3,(H,22,26) |
| InChIKey | YEZUTSCCOYDYPN-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-benzyl-5-tert-butyl-N-(3-sulfinamoylphenyl)-1,2,4-triazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzyl-5-tert-butyl-N-(3-sulfinamoylphenyl)-1,2,4-triazole-3-carboxamide?
The IUPAC name of 2-benzyl-5-tert-butyl-N-(3-sulfinamoylphenyl)-1,2,4-triazole-3-carboxamide (CID 143790585) is 2-benzyl-5-tert-butyl-N-(3-sulfinamoylphenyl)-1,2,4-triazole-3-carboxamide.
What is the SMILES notation for 2-benzyl-5-tert-butyl-N-(3-sulfinamoylphenyl)-1,2,4-triazole-3-carboxamide?
The canonical SMILES for 2-benzyl-5-tert-butyl-N-(3-sulfinamoylphenyl)-1,2,4-triazole-3-carboxamide is CC(C)(C)c1nc(C(=O)Nc2cccc(S(N)=O)c2)n(Cc2ccccc2)n1.
What is the InChIKey of 2-benzyl-5-tert-butyl-N-(3-sulfinamoylphenyl)-1,2,4-triazole-3-carboxamide?
The InChIKey is YEZUTSCCOYDYPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23N5O2S/c1-20(2,3)19-23-17(25(24-19)13-14-8-5-4-6-9-14)18(26)22-15-10-7-11-16(12-15)28(21)27/h4-12H,13,21H2,1-3H3,(H,22,26).
What are the key properties of 2-benzyl-5-tert-butyl-N-(3-sulfinamoylphenyl)-1,2,4-triazole-3-carboxamide?
2-benzyl-5-tert-butyl-N-(3-sulfinamoylphenyl)-1,2,4-triazole-3-carboxamide has a molecular weight of 397.50 g/mol, XLogP of 2.86, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyl-5-tert-butyl-N-(3-sulfinamoylphenyl)-1,2,4-triazole-3-carboxamide is sourced from PubChem (CID 143790585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).