C17H17IO3 — CID 143790931
[[4-(2-hydroxy-2-methylpropanoyl)phenyl]-phenylmethyl] hypoiodite (PubChem CID 143790931) has the molecular formula C17H17IO3 and a molecular weight of 396.22 g/mol. Its IUPAC name is [[4-(2-hydroxy-2-methylpropanoyl)phenyl]-phenylmethyl] hypoiodite.
| Compound Name | [[4-(2-hydroxy-2-methylpropanoyl)phenyl]-phenylmethyl] hypoiodite |
|---|---|
| PubChem CID | 143790931 |
| Molecular Formula | C17H17IO3 |
| Molecular Weight | 396.22 g/mol |
| Exact Mass | 396.02 |
| IUPAC Name | [[4-(2-hydroxy-2-methylpropanoyl)phenyl]-phenylmethyl] hypoiodite |
| SMILES | CC(C)(O)C(=O)c1ccc(C(OI)c2ccccc2)cc1 |
| InChI | InChI=1S/C17H17IO3/c1-17(2,20)16(19)14-10-8-13(9-11-14)15(21-18)12-6-4-3-5-7-12/h3-11,15,20H,1-2H3 |
| InChIKey | DAYSGNKCNWNBCW-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.22 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|