About 1-[3-(hydroxyamino)-1,2,4-triazol-1-yl]propan-2-ol
1-[3-(hydroxyamino)-1,2,4-triazol-1-yl]propan-2-ol (PubChem CID 143790978) has the molecular formula C5H10N4O2
and a molecular weight of 158.16 g/mol. Its IUPAC name is 1-[3-(hydroxyamino)-1,2,4-triazol-1-yl]propan-2-ol.
Molecular Properties
| Compound Name | 1-[3-(hydroxyamino)-1,2,4-triazol-1-yl]propan-2-ol |
| PubChem CID | 143790978 |
| Molecular Formula | C5H10N4O2 |
| Molecular Weight | 158.16 g/mol |
| Exact Mass | 158.08 |
| IUPAC Name | 1-[3-(hydroxyamino)-1,2,4-triazol-1-yl]propan-2-ol |
| SMILES | CC(O)Cn1cnc(NO)n1 |
| InChI | InChI=1S/C5H10N4O2/c1-4(10)2-9-3-6-5(7-9)8-11/h3-4,10-11H,2H2,1H3,(H,7,8) |
| InChIKey | DUZXTRWPTJQFKR-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 83.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.16 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[3-(hydroxyamino)-1,2,4-triazol-1-yl]propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(hydroxyamino)-1,2,4-triazol-1-yl]propan-2-ol?
The IUPAC name of 1-[3-(hydroxyamino)-1,2,4-triazol-1-yl]propan-2-ol (CID 143790978) is 1-[3-(hydroxyamino)-1,2,4-triazol-1-yl]propan-2-ol.
What is the SMILES notation for 1-[3-(hydroxyamino)-1,2,4-triazol-1-yl]propan-2-ol?
The canonical SMILES for 1-[3-(hydroxyamino)-1,2,4-triazol-1-yl]propan-2-ol is CC(O)Cn1cnc(NO)n1.
What is the InChIKey of 1-[3-(hydroxyamino)-1,2,4-triazol-1-yl]propan-2-ol?
The InChIKey is DUZXTRWPTJQFKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N4O2/c1-4(10)2-9-3-6-5(7-9)8-11/h3-4,10-11H,2H2,1H3,(H,7,8).
What are the key properties of 1-[3-(hydroxyamino)-1,2,4-triazol-1-yl]propan-2-ol?
1-[3-(hydroxyamino)-1,2,4-triazol-1-yl]propan-2-ol has a molecular weight of 158.16 g/mol, XLogP of -0.54, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(hydroxyamino)-1,2,4-triazol-1-yl]propan-2-ol is sourced from PubChem (CID 143790978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).