C22H30O5SSi — CID 14379126
[(1S,3R,4R)-4-[dimethyl(phenyl)silyl]-3-methyl-3-[(1S)-1-methyl-4-oxocyclohex-2-en-1-yl]-2-oxocyclopentyl] methanesulfonate (PubChem CID 14379126) has the molecular formula C22H30O5SSi and a molecular weight of 434.63 g/mol. Its IUPAC name is [(1S,3R,4R)-4-[dimethyl(phenyl)silyl]-3-methyl-3-[(1S)-1-methyl-4-oxocyclohex-2-en-1-yl]-2-oxocyclopentyl] methanesulfonate.
| Compound Name | [(1S,3R,4R)-4-[dimethyl(phenyl)silyl]-3-methyl-3-[(1S)-1-methyl-4-oxocyclohex-2-en-1-yl]-2-oxocyclopentyl] methanesulfonate |
|---|---|
| PubChem CID | 14379126 |
| Molecular Formula | C22H30O5SSi |
| Molecular Weight | 434.63 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | [(1S,3R,4R)-4-[dimethyl(phenyl)silyl]-3-methyl-3-[(1S)-1-methyl-4-oxocyclohex-2-en-1-yl]-2-oxocyclopentyl] methanesulfonate |
| SMILES | C[C@@]1([C@]2(C)C(=O)[C@@H](OS(C)(=O)=O)C[C@H]2[Si](C)(C)c2ccccc2)C=CC(=O)CC1 |
| InChI | InChI=1S/C22H30O5SSi/c1-21(13-11-16(23)12-14-21)22(2)19(15-18(20(22)24)27-28(3,25)26)29(4,5)17-9-7-6-8-10-17/h6-11,13,18-19H,12,14-15H2,1-5H3/t18-,19+,21+,22-/m0/s1 |
| InChIKey | ZVAOFTVJVHSYCY-PSBKLILYSA-N |
| XLogP | 3.22 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.63 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|