About 4-fluorocyclohexa-1,5-diene-1-carbohydrazide
4-fluorocyclohexa-1,5-diene-1-carbohydrazide (PubChem CID 143791470) has the molecular formula C7H9FN2O
and a molecular weight of 156.16 g/mol. Its IUPAC name is 4-fluorocyclohexa-1,5-diene-1-carbohydrazide.
Molecular Properties
| Compound Name | 4-fluorocyclohexa-1,5-diene-1-carbohydrazide |
| PubChem CID | 143791470 |
| Molecular Formula | C7H9FN2O |
| Molecular Weight | 156.16 g/mol |
| Exact Mass | 156.07 |
| IUPAC Name | 4-fluorocyclohexa-1,5-diene-1-carbohydrazide |
| SMILES | NNC(=O)C1=CCC(F)C=C1 |
| InChI | InChI=1S/C7H9FN2O/c8-6-3-1-5(2-4-6)7(11)10-9/h1-3,6H,4,9H2,(H,10,11) |
| InChIKey | AUQKBUKQXKGZNU-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.16 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-fluorocyclohexa-1,5-diene-1-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluorocyclohexa-1,5-diene-1-carbohydrazide?
The IUPAC name of 4-fluorocyclohexa-1,5-diene-1-carbohydrazide (CID 143791470) is 4-fluorocyclohexa-1,5-diene-1-carbohydrazide.
What is the SMILES notation for 4-fluorocyclohexa-1,5-diene-1-carbohydrazide?
The canonical SMILES for 4-fluorocyclohexa-1,5-diene-1-carbohydrazide is NNC(=O)C1=CCC(F)C=C1.
What is the InChIKey of 4-fluorocyclohexa-1,5-diene-1-carbohydrazide?
The InChIKey is AUQKBUKQXKGZNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9FN2O/c8-6-3-1-5(2-4-6)7(11)10-9/h1-3,6H,4,9H2,(H,10,11).
What are the key properties of 4-fluorocyclohexa-1,5-diene-1-carbohydrazide?
4-fluorocyclohexa-1,5-diene-1-carbohydrazide has a molecular weight of 156.16 g/mol, XLogP of 0.20, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluorocyclohexa-1,5-diene-1-carbohydrazide is sourced from PubChem (CID 143791470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).