C28H48O — CID 14379148
(6E,10E,14E,18E)-22-methoxy-2,6,10,15,19-pentamethyldocosa-2,6,10,14,18-pentaene (PubChem CID 14379148) has the molecular formula C28H48O and a molecular weight of 400.69 g/mol. Its IUPAC name is (6E,10E,14E,18E)-22-methoxy-2,6,10,15,19-pentamethyldocosa-2,6,10,14,18-pentaene.
| Compound Name | (6E,10E,14E,18E)-22-methoxy-2,6,10,15,19-pentamethyldocosa-2,6,10,14,18-pentaene |
|---|---|
| PubChem CID | 14379148 |
| Molecular Formula | C28H48O |
| Molecular Weight | 400.69 g/mol |
| Exact Mass | 400.37 |
| IUPAC Name | (6E,10E,14E,18E)-22-methoxy-2,6,10,15,19-pentamethyldocosa-2,6,10,14,18-pentaene |
| SMILES | COCCC/C(C)=C/CC/C(C)=C/CC/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C28H48O/c1-24(2)14-10-17-27(5)20-11-18-25(3)15-8-9-16-26(4)19-12-21-28(6)22-13-23-29-7/h14-16,20-21H,8-13,17-19,22-23H2,1-7H3/b25-15+,26-16+,27-20+,28-21+ |
| InChIKey | OFMDCCLOLCUHCB-BANQPHDMSA-N |
| XLogP | 9.29 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.69 |
| LogP ≤ 5 | 9.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|