About (4Z,6Z)-4-ethenyl-N-ethyl-6-[2-(oxan-4-yl)ethyl]octa-4,6-dien-1-amine
(4Z,6Z)-4-ethenyl-N-ethyl-6-[2-(oxan-4-yl)ethyl]octa-4,6-dien-1-amine (PubChem CID 143792151) has the molecular formula C19H33NO
and a molecular weight of 291.48 g/mol. Its IUPAC name is (4Z,6Z)-4-ethenyl-N-ethyl-6-[2-(oxan-4-yl)ethyl]octa-4,6-dien-1-amine.
Molecular Properties
| Compound Name | (4Z,6Z)-4-ethenyl-N-ethyl-6-[2-(oxan-4-yl)ethyl]octa-4,6-dien-1-amine |
| PubChem CID | 143792151 |
| Molecular Formula | C19H33NO |
| Molecular Weight | 291.48 g/mol |
| Exact Mass | 291.26 |
| IUPAC Name | (4Z,6Z)-4-ethenyl-N-ethyl-6-[2-(oxan-4-yl)ethyl]octa-4,6-dien-1-amine |
| SMILES | C=C/C(=C\C(=C/C)CCC1CCOCC1)CCCNCC |
| InChI | InChI=1S/C19H33NO/c1-4-17(8-7-13-20-6-3)16-18(5-2)9-10-19-11-14-21-15-12-19/h4-5,16,19-20H,1,6-15H2,2-3H3/b17-16+,18-5- |
| InChIKey | CIKQIIDOMQOIGI-PDUBBGFBSA-N |
| XLogP | 4.64 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.48 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (4Z,6Z)-4-ethenyl-N-ethyl-6-[2-(oxan-4-yl)ethyl]octa-4,6-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z,6Z)-4-ethenyl-N-ethyl-6-[2-(oxan-4-yl)ethyl]octa-4,6-dien-1-amine?
The IUPAC name of (4Z,6Z)-4-ethenyl-N-ethyl-6-[2-(oxan-4-yl)ethyl]octa-4,6-dien-1-amine (CID 143792151) is (4Z,6Z)-4-ethenyl-N-ethyl-6-[2-(oxan-4-yl)ethyl]octa-4,6-dien-1-amine.
What is the SMILES notation for (4Z,6Z)-4-ethenyl-N-ethyl-6-[2-(oxan-4-yl)ethyl]octa-4,6-dien-1-amine?
The canonical SMILES for (4Z,6Z)-4-ethenyl-N-ethyl-6-[2-(oxan-4-yl)ethyl]octa-4,6-dien-1-amine is C=C/C(=C\C(=C/C)CCC1CCOCC1)CCCNCC.
What is the InChIKey of (4Z,6Z)-4-ethenyl-N-ethyl-6-[2-(oxan-4-yl)ethyl]octa-4,6-dien-1-amine?
The InChIKey is CIKQIIDOMQOIGI-PDUBBGFBSA-N. The full InChI is InChI=1S/C19H33NO/c1-4-17(8-7-13-20-6-3)16-18(5-2)9-10-19-11-14-21-15-12-19/h4-5,16,19-20H,1,6-15H2,2-3H3/b17-16+,18-5-.
What are the key properties of (4Z,6Z)-4-ethenyl-N-ethyl-6-[2-(oxan-4-yl)ethyl]octa-4,6-dien-1-amine?
(4Z,6Z)-4-ethenyl-N-ethyl-6-[2-(oxan-4-yl)ethyl]octa-4,6-dien-1-amine has a molecular weight of 291.48 g/mol, XLogP of 4.64, 10 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z,6Z)-4-ethenyl-N-ethyl-6-[2-(oxan-4-yl)ethyl]octa-4,6-dien-1-amine is sourced from PubChem (CID 143792151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).