C15H29N3O — CID 143792193
1-[(2Z,4Z)-4-methoxy-1-piperidin-4-ylhepta-2,4-dien-3-yl]-1,2-dimethylhydrazine (PubChem CID 143792193) has the molecular formula C15H29N3O and a molecular weight of 267.42 g/mol. Its IUPAC name is 1-[(2Z,4Z)-4-methoxy-1-piperidin-4-ylhepta-2,4-dien-3-yl]-1,2-dimethylhydrazine.
| Compound Name | 1-[(2Z,4Z)-4-methoxy-1-piperidin-4-ylhepta-2,4-dien-3-yl]-1,2-dimethylhydrazine |
|---|---|
| PubChem CID | 143792193 |
| Molecular Formula | C15H29N3O |
| Molecular Weight | 267.42 g/mol |
| Exact Mass | 267.23 |
| IUPAC Name | 1-[(2Z,4Z)-4-methoxy-1-piperidin-4-ylhepta-2,4-dien-3-yl]-1,2-dimethylhydrazine |
| SMILES | CC/C=C(OC)/C(=C/CC1CCNCC1)N(C)NC |
| InChI | InChI=1S/C15H29N3O/c1-5-6-15(19-4)14(18(3)16-2)8-7-13-9-11-17-12-10-13/h6,8,13,16-17H,5,7,9-12H2,1-4H3/b14-8-,15-6- |
| InChIKey | GDGGWEVHLVOWDZ-PETHTGEPSA-N |
| XLogP | 2.27 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.42 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|