C16H25KN2O2 — CID 143792254
potassium N-[[4-[(2E,4Z)-hepta-2,4,6-trien-3-yl]piperidin-1-id-4-yl]methyl]-2-methoxyacetamide (PubChem CID 143792254) has the molecular formula C16H25KN2O2 and a molecular weight of 316.49 g/mol. Its IUPAC name is potassium N-[[4-[(2E,4Z)-hepta-2,4,6-trien-3-yl]piperidin-1-id-4-yl]methyl]-2-methoxyacetamide.
| Compound Name | potassium N-[[4-[(2E,4Z)-hepta-2,4,6-trien-3-yl]piperidin-1-id-4-yl]methyl]-2-methoxyacetamide |
|---|---|
| PubChem CID | 143792254 |
| Molecular Formula | C16H25KN2O2 |
| Molecular Weight | 316.49 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | potassium N-[[4-[(2E,4Z)-hepta-2,4,6-trien-3-yl]piperidin-1-id-4-yl]methyl]-2-methoxyacetamide |
| SMILES | C=C/C=C\C(=C/C)C1(CNC(=O)COC)CC[N-]CC1.[K+] |
| InChI | InChI=1S/C16H25N2O2.K/c1-4-6-7-14(5-2)16(8-10-17-11-9-16)13-18-15(19)12-20-3;/h4-7H,1,8-13H2,2-3H3,(H,18,19);/q-1;+1/b7-6-,14-5+; |
| InChIKey | LCGUKQNIGVQGTK-QVTMYGKOSA-N |
| XLogP | -0.40 |
| TPSA | 52.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.49 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|