C14H22N2O — CID 143792302
4-ethyl-4-phenylpiperidine;formamide (PubChem CID 143792302) has the molecular formula C14H22N2O and a molecular weight of 234.34 g/mol. Its IUPAC name is 4-ethyl-4-phenylpiperidine;formamide.
| Compound Name | 4-ethyl-4-phenylpiperidine;formamide |
|---|---|
| PubChem CID | 143792302 |
| Molecular Formula | C14H22N2O |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.17 |
| IUPAC Name | 4-ethyl-4-phenylpiperidine;formamide |
| SMILES | CCC1(c2ccccc2)CCNCC1.NC=O |
| InChI | InChI=1S/C13H19N.CH3NO/c1-2-13(8-10-14-11-9-13)12-6-4-3-5-7-12;2-1-3/h3-7,14H,2,8-11H2,1H3;1H,(H2,2,3) |
| InChIKey | FBZXQSOHECSQTM-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|