About N-methyl-N-[(4-phenyl-3,5-dihydro-2H-pyridin-4-yl)methyl]methanesulfonamide
N-methyl-N-[(4-phenyl-3,5-dihydro-2H-pyridin-4-yl)methyl]methanesulfonamide (PubChem CID 143792358) has the molecular formula C14H20N2O2S
and a molecular weight of 280.39 g/mol. Its IUPAC name is N-methyl-N-[(4-phenyl-3,5-dihydro-2H-pyridin-4-yl)methyl]methanesulfonamide.
Molecular Properties
| Compound Name | N-methyl-N-[(4-phenyl-3,5-dihydro-2H-pyridin-4-yl)methyl]methanesulfonamide |
| PubChem CID | 143792358 |
| Molecular Formula | C14H20N2O2S |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | N-methyl-N-[(4-phenyl-3,5-dihydro-2H-pyridin-4-yl)methyl]methanesulfonamide |
| SMILES | CN(CC1(c2ccccc2)CC=NCC1)S(C)(=O)=O |
| InChI | InChI=1S/C14H20N2O2S/c1-16(19(2,17)18)12-14(8-10-15-11-9-14)13-6-4-3-5-7-13/h3-7,10H,8-9,11-12H2,1-2H3 |
| InChIKey | OWQJBJAILZDTEM-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-methyl-N-[(4-phenyl-3,5-dihydro-2H-pyridin-4-yl)methyl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N-[(4-phenyl-3,5-dihydro-2H-pyridin-4-yl)methyl]methanesulfonamide?
The IUPAC name of N-methyl-N-[(4-phenyl-3,5-dihydro-2H-pyridin-4-yl)methyl]methanesulfonamide (CID 143792358) is N-methyl-N-[(4-phenyl-3,5-dihydro-2H-pyridin-4-yl)methyl]methanesulfonamide.
What is the SMILES notation for N-methyl-N-[(4-phenyl-3,5-dihydro-2H-pyridin-4-yl)methyl]methanesulfonamide?
The canonical SMILES for N-methyl-N-[(4-phenyl-3,5-dihydro-2H-pyridin-4-yl)methyl]methanesulfonamide is CN(CC1(c2ccccc2)CC=NCC1)S(C)(=O)=O.
What is the InChIKey of N-methyl-N-[(4-phenyl-3,5-dihydro-2H-pyridin-4-yl)methyl]methanesulfonamide?
The InChIKey is OWQJBJAILZDTEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N2O2S/c1-16(19(2,17)18)12-14(8-10-15-11-9-14)13-6-4-3-5-7-13/h3-7,10H,8-9,11-12H2,1-2H3.
What are the key properties of N-methyl-N-[(4-phenyl-3,5-dihydro-2H-pyridin-4-yl)methyl]methanesulfonamide?
N-methyl-N-[(4-phenyl-3,5-dihydro-2H-pyridin-4-yl)methyl]methanesulfonamide has a molecular weight of 280.39 g/mol, XLogP of 1.68, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N-[(4-phenyl-3,5-dihydro-2H-pyridin-4-yl)methyl]methanesulfonamide is sourced from PubChem (CID 143792358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).