About 4-(4-methoxy-1-methylcyclohexa-2,4-dien-1-yl)piperidine
4-(4-methoxy-1-methylcyclohexa-2,4-dien-1-yl)piperidine (PubChem CID 143792414) has the molecular formula C13H21NO
and a molecular weight of 207.32 g/mol. Its IUPAC name is 4-(4-methoxy-1-methylcyclohexa-2,4-dien-1-yl)piperidine.
Molecular Properties
| Compound Name | 4-(4-methoxy-1-methylcyclohexa-2,4-dien-1-yl)piperidine |
| PubChem CID | 143792414 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | 4-(4-methoxy-1-methylcyclohexa-2,4-dien-1-yl)piperidine |
| SMILES | COC1=CCC(C)(C2CCNCC2)C=C1 |
| InChI | InChI=1S/C13H21NO/c1-13(11-5-9-14-10-6-11)7-3-12(15-2)4-8-13/h3-4,7,11,14H,5-6,8-10H2,1-2H3 |
| InChIKey | LHCPFUZAQXAUOJ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(4-methoxy-1-methylcyclohexa-2,4-dien-1-yl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-methoxy-1-methylcyclohexa-2,4-dien-1-yl)piperidine?
The IUPAC name of 4-(4-methoxy-1-methylcyclohexa-2,4-dien-1-yl)piperidine (CID 143792414) is 4-(4-methoxy-1-methylcyclohexa-2,4-dien-1-yl)piperidine.
What is the SMILES notation for 4-(4-methoxy-1-methylcyclohexa-2,4-dien-1-yl)piperidine?
The canonical SMILES for 4-(4-methoxy-1-methylcyclohexa-2,4-dien-1-yl)piperidine is COC1=CCC(C)(C2CCNCC2)C=C1.
What is the InChIKey of 4-(4-methoxy-1-methylcyclohexa-2,4-dien-1-yl)piperidine?
The InChIKey is LHCPFUZAQXAUOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21NO/c1-13(11-5-9-14-10-6-11)7-3-12(15-2)4-8-13/h3-4,7,11,14H,5-6,8-10H2,1-2H3.
What are the key properties of 4-(4-methoxy-1-methylcyclohexa-2,4-dien-1-yl)piperidine?
4-(4-methoxy-1-methylcyclohexa-2,4-dien-1-yl)piperidine has a molecular weight of 207.32 g/mol, XLogP of 2.48, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-methoxy-1-methylcyclohexa-2,4-dien-1-yl)piperidine is sourced from PubChem (CID 143792414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).