C12H18N2O — CID 143792426
4,5-dimethyl-3-phenyl-5H-1,2,4-oxadiazole;ethane (PubChem CID 143792426) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is 4,5-dimethyl-3-phenyl-5H-1,2,4-oxadiazole;ethane.
| Compound Name | 4,5-dimethyl-3-phenyl-5H-1,2,4-oxadiazole;ethane |
|---|---|
| PubChem CID | 143792426 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | 4,5-dimethyl-3-phenyl-5H-1,2,4-oxadiazole;ethane |
| SMILES | CC.CC1ON=C(c2ccccc2)N1C |
| InChI | InChI=1S/C10H12N2O.C2H6/c1-8-12(2)10(11-13-8)9-6-4-3-5-7-9;1-2/h3-8H,1-2H3;1-2H3 |
| InChIKey | NUYJHZBCMCIPOU-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |