C25H29NS — CID 143792769
1-[(1E)-4,7-dimethyl-1-thiophen-2-ylocta-1,6-dien-4-yl]-N-methylnaphthalen-2-amine (PubChem CID 143792769) has the molecular formula C25H29NS and a molecular weight of 375.58 g/mol. Its IUPAC name is 1-[(1E)-4,7-dimethyl-1-thiophen-2-ylocta-1,6-dien-4-yl]-N-methylnaphthalen-2-amine.
| Compound Name | 1-[(1E)-4,7-dimethyl-1-thiophen-2-ylocta-1,6-dien-4-yl]-N-methylnaphthalen-2-amine |
|---|---|
| PubChem CID | 143792769 |
| Molecular Formula | C25H29NS |
| Molecular Weight | 375.58 g/mol |
| Exact Mass | 375.20 |
| IUPAC Name | 1-[(1E)-4,7-dimethyl-1-thiophen-2-ylocta-1,6-dien-4-yl]-N-methylnaphthalen-2-amine |
| SMILES | CNc1ccc2ccccc2c1C(C)(CC=C(C)C)C/C=C/c1cccs1 |
| InChI | InChI=1S/C25H29NS/c1-19(2)15-17-25(3,16-7-10-21-11-8-18-27-21)24-22-12-6-5-9-20(22)13-14-23(24)26-4/h5-15,18,26H,16-17H2,1-4H3/b10-7+ |
| InChIKey | ZQHBXBYFNYSAPH-JXMROGBWSA-N |
| XLogP | 7.66 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.58 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|